CAS 1204810-57-0 appears in our catalog under these names: 3,4-Dichloro-7-methoxyquinoline, 95%, 3,4-Dichloro-7-methoxyquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
3,4-dichloro-7-methoxyquinoline (CAS 1204810-57-0) is a chemical compound with the molecular formula C10H7Cl2NO and a molecular weight of 228.07 g/mol. IUPAC name: 3,4-dichloro-7-methoxyquinoline. InChIKey: UJIHLIZYHGVCSR-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 3,4-dichloro-7-methoxyquinoline |
| InChIKey | UJIHLIZYHGVCSR-UHFFFAOYSA-N |
| SMILES | COC1=CC2=NC=C(C(=C2C=C1)Cl)Cl |
Computed by PubChem (NCBI)