CAS 942035-78-1 appears in our catalog under these names: 4-Chloro-3-fluorobenzenesulfonamide, 97%, 4-Chloro-3-fluorobenzene sulfonamide. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 1g.
4-chloro-3-fluorobenzenesulfonamide (CAS 942035-78-1) is a chemical compound with the molecular formula C6H5ClFNO2S and a molecular weight of 209.63 g/mol. IUPAC name: 4-chloro-3-fluorobenzenesulfonamide. InChIKey: DMKAKLSLWSJYKB-UHFFFAOYSA-N.
| Molecular formula | C6H5ClFNO2S |
|---|---|
| Molecular weight | 209.63 g/mol |
| IUPAC name | 4-chloro-3-fluorobenzenesulfonamide |
| InChIKey | DMKAKLSLWSJYKB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1S(=O)(=O)N)F)Cl |
Computed by PubChem (NCBI)