CAS 1210868-11-3 is the registry number for 6-Methylpyridine-3-sulfonyl chloride hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
6-methylpyridine-3-sulfonyl chloride;hydrochloride (CAS 1210868-11-3) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: 6-methylpyridine-3-sulfonyl chloride;hydrochloride. InChIKey: ZRHZDDQNZAOIFU-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2NO2S |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 6-methylpyridine-3-sulfonyl chloride;hydrochloride |
| InChIKey | ZRHZDDQNZAOIFU-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)