Products 1210868-11-3

CAS 1210868-11-3 is the registry number for 6-Methylpyridine-3-sulfonyl chloride hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.

Structural formula: {0} (CAS {1})

6-methylpyridine-3-sulfonyl chloride;hydrochloride (CAS 1210868-11-3) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: 6-methylpyridine-3-sulfonyl chloride;hydrochloride. InChIKey: ZRHZDDQNZAOIFU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Cl2NO2S
Molecular weight228.10 g/mol
IUPAC name6-methylpyridine-3-sulfonyl chloride;hydrochloride
InChIKeyZRHZDDQNZAOIFU-UHFFFAOYSA-N
SMILESCC1=NC=C(C=C1)S(=O)(=O)Cl.Cl

Computed by PubChem (NCBI)