Products 1220039-42-8

CAS 1220039-42-8 appears in our catalog under these names: 4-Methyl-pyridine-2-sulfonyl chloride hydrochloride, 95%, 4-Methylpyridine-2-sulfonyl chloride hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 50mg.

Structural formula: {0} (CAS {1})

4-methylpyridine-2-sulfonyl chloride;hydrochloride (CAS 1220039-42-8) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: 4-methylpyridine-2-sulfonyl chloride;hydrochloride. InChIKey: UIRYHRFHNOYLBS-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Cl2NO2S
Molecular weight228.10 g/mol
IUPAC name4-methylpyridine-2-sulfonyl chloride;hydrochloride
InChIKeyUIRYHRFHNOYLBS-UHFFFAOYSA-N
SMILESCC1=CC(=NC=C1)S(=O)(=O)Cl.Cl

Computed by PubChem (NCBI)