CAS 683812-81-9 is the registry number for Pyridin-4-ylmethanesulfonyl chloride hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Pyridin-4-ylmethanesulfonyl chloride;hydrochloride (CAS 683812-81-9) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: pyridin-4-ylmethanesulfonyl chloride;hydrochloride. InChIKey: JZZPWTOVADCTSK-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2NO2S |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | pyridin-4-ylmethanesulfonyl chloride;hydrochloride |
| InChIKey | JZZPWTOVADCTSK-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1CS(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)