CAS 2228891-40-3 appears in our catalog under these names: Methyl 3-amino-5-chlorothiophene-2-carboxylate hydrochloride, Methyl 3-amino-5-chlorothiophene-2-carboxylate hydrochloride, 98%, Methyl 3-amino-5-chlorothiophene-2-carboxylate hydrochloride, 98%, 98%. Offered by: Biosynth, AmBeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 1g, 100mg, 250mg.
Methyl 3-amino-5-chlorothiophene-2-carboxylate;hydrochloride (CAS 2228891-40-3) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: methyl 3-amino-5-chlorothiophene-2-carboxylate;hydrochloride. InChIKey: LYSBJDCSAJQHCB-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2NO2S |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | methyl 3-amino-5-chlorothiophene-2-carboxylate;hydrochloride |
| InChIKey | LYSBJDCSAJQHCB-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(S1)Cl)N.Cl |
Computed by PubChem (NCBI)