Products 191105-35-8

CAS 191105-35-8 is the registry number for Pyridine-3-yl-methanesulfonyl Chloride Hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Pyridin-3-ylmethanesulfonyl chloride;hydrochloride (CAS 191105-35-8) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: pyridin-3-ylmethanesulfonyl chloride;hydrochloride. InChIKey: FKDIJPAPYLRXPR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Cl2NO2S
Molecular weight228.10 g/mol
IUPAC namepyridin-3-ylmethanesulfonyl chloride;hydrochloride
InChIKeyFKDIJPAPYLRXPR-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)CS(=O)(=O)Cl.Cl

Computed by PubChem (NCBI)