CAS 1417793-77-1 is the registry number for 2-Aminobenzene-1-sulfonyl chloride hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
2-aminobenzenesulfonyl chloride;hydrochloride (CAS 1417793-77-1) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: 2-aminobenzenesulfonyl chloride;hydrochloride. InChIKey: CWUXFQYGNBABET-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2NO2S |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 2-aminobenzenesulfonyl chloride;hydrochloride |
| InChIKey | CWUXFQYGNBABET-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)