Products 2444918-28-7
CAS 2444918-28-7 appears in our catalog under these names: 5-Methylpyridine-3-sulfonyl chloride hydrochloride, 98%, 5-Methyl-3-pyridine sulfonyl chloride hydrochloride, 98%, 98%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
5-methylpyridine-3-sulfonyl chloride;hydrochloride (CAS 2444918-28-7) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: 5-methylpyridine-3-sulfonyl chloride;hydrochloride. InChIKey: VZJQZUMPBMGRFG-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2NO2S |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 5-methylpyridine-3-sulfonyl chloride;hydrochloride |
| InChIKey | VZJQZUMPBMGRFG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)