CAS 78798-60-4 is the registry number for 4-Aminobenzenesulfonyl chloride hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-aminobenzenesulfonyl chloride;hydrochloride (CAS 78798-60-4) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: 4-aminobenzenesulfonyl chloride;hydrochloride. InChIKey: RDRDUBPVWACSIO-UHFFFAOYSA-N.
| Molecular formula | C6H7Cl2NO2S |
|---|---|
| Molecular weight | 228.10 g/mol |
| IUPAC name | 4-aminobenzenesulfonyl chloride;hydrochloride |
| InChIKey | RDRDUBPVWACSIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)