Products 2172602-44-5

CAS 2172602-44-5 is the registry number for 4-(Aminomethyl)-5-chlorothiophene-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(aminomethyl)-5-chlorothiophene-2-carboxylic acid;hydrochloride (CAS 2172602-44-5) is a chemical compound with the molecular formula C6H7Cl2NO2S and a molecular weight of 228.10 g/mol. IUPAC name: 4-(aminomethyl)-5-chlorothiophene-2-carboxylic acid;hydrochloride. InChIKey: GURVGBGZZGLKTA-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7Cl2NO2S
Molecular weight228.10 g/mol
IUPAC name4-(aminomethyl)-5-chlorothiophene-2-carboxylic acid;hydrochloride
InChIKeyGURVGBGZZGLKTA-UHFFFAOYSA-N
SMILESC1=C(SC(=C1CN)Cl)C(=O)O.Cl

Computed by PubChem (NCBI)