CAS 1211428-89-5 appears in our catalog under these names: 2-(2,5-Dichlorophenoxy)ethan-1-amine hydrochloride, 97%, 2-(2,5-Dichlorophenoxy)ethan-1-amine hydrochloride, 97%, 97%, [2-(2,5-dichlorophenoxy)ethyl]amine hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g.
2-(2,5-dichlorophenoxy)ethanamine;hydrochloride (CAS 1211428-89-5) is a chemical compound with the molecular formula C8H10Cl3NO and a molecular weight of 242.5 g/mol. IUPAC name: 2-(2,5-dichlorophenoxy)ethanamine;hydrochloride. InChIKey: ZUBHAKSZEQLVLR-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3NO |
|---|---|
| Molecular weight | 242.5 g/mol |
| IUPAC name | 2-(2,5-dichlorophenoxy)ethanamine;hydrochloride |
| InChIKey | ZUBHAKSZEQLVLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCCN)Cl.Cl |
Computed by PubChem (NCBI)