Products 1211578-56-1

CAS 1211578-56-1 is the registry number for 3-Methyl-5-nitropicolinic acid, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.

3-methyl-5-nitropyridine-2-carboxylic acid (CAS 1211578-56-1) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-methyl-5-nitropyridine-2-carboxylic acid. InChIKey: JJDGXHPKVXOWHN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6N2O4
Molecular weight182.13 g/mol
IUPAC name3-methyl-5-nitropyridine-2-carboxylic acid
InChIKeyJJDGXHPKVXOWHN-UHFFFAOYSA-N
SMILESCC1=CC(=CN=C1C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)