CAS 1211578-56-1 is the registry number for 3-Methyl-5-nitropicolinic acid, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3-methyl-5-nitropyridine-2-carboxylic acid (CAS 1211578-56-1) is a chemical compound with the molecular formula C7H6N2O4 and a molecular weight of 182.13 g/mol. IUPAC name: 3-methyl-5-nitropyridine-2-carboxylic acid. InChIKey: JJDGXHPKVXOWHN-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4 |
|---|---|
| Molecular weight | 182.13 g/mol |
| IUPAC name | 3-methyl-5-nitropyridine-2-carboxylic acid |
| InChIKey | JJDGXHPKVXOWHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)