Products 1360891-58-2
CAS 1360891-58-2 is the registry number for (5,6-Difluoro-1H-indol-3-yl)methanamine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5,6-difluoro-1H-indol-3-yl)methanamine (CAS 1360891-58-2) is a chemical compound with the molecular formula C9H8F2N2 and a molecular weight of 182.17 g/mol. IUPAC name: (5,6-difluoro-1H-indol-3-yl)methanamine. InChIKey: UZLOEGZHDFATSW-UHFFFAOYSA-N.
| Molecular formula | C9H8F2N2 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | (5,6-difluoro-1H-indol-3-yl)methanamine |
| InChIKey | UZLOEGZHDFATSW-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)F)NC=C2CN |
Computed by PubChem (NCBI)