Products 1214364-06-3
CAS 1214364-06-3 is the registry number for 2-(Difluoromethoxy)-4,5-difluorobenzoic acid, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
2-(difluoromethoxy)-4,5-difluorobenzoic acid (CAS 1214364-06-3) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2-(difluoromethoxy)-4,5-difluorobenzoic acid. InChIKey: SSGIPPQWBSHBPW-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2-(difluoromethoxy)-4,5-difluorobenzoic acid |
| InChIKey | SSGIPPQWBSHBPW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)F)OC(F)F)C(=O)O |
Computed by PubChem (NCBI)