CAS 2060062-92-0 appears in our catalog under these names: 2-(2,4-Difluorophenyl)-2,2-difluoroethan-1-amine hydrochloride, 95%, 2–(2,4–Difluorophenyl)–2,2–difluoroethan–1–amine hydrochloride, 2-(2,4-Difluorophenyl)-2,2-difluoroethan-1-amine hydrochloride, 95%, 95%. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 100mg, 250mg.
2-(2,4-difluorophenyl)-2,2-difluoroethanamine;hydrochloride (CAS 2060062-92-0) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: YTCHRHAJVBEPHB-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | YTCHRHAJVBEPHB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(CN)(F)F.Cl |
Computed by PubChem (NCBI)