Products 1217445-26-5
CAS 1217445-26-5 is the registry number for (13C3D4)-N-Boc-L-Alanine. Offered by: TRC. Available pack sizes: 25mg.
(2S)-2,3,3,3-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino](1,2,3-13C3)propanoic acid (CAS 1217445-26-5) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 196.21 g/mol. IUPAC name: (2S)-2,3,3,3-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino](1,2,3-13C3)propanoic acid. InChIKey: QVHJQCGUWFKTSE-KFGGSPPGSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 196.21 g/mol |
| IUPAC name | (2S)-2,3,3,3-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino](1,2,3-13C3)propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-KFGGSPPGSA-N |
| SMILES | [2H][13C@@]([13C](=O)O)([13C]([2H])([2H])[2H])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)