CAS 161602-47-7 appears in our catalog under these names: L-Alanine-3,3,3-d3-N-t-BOC, 99 atom % D, min 98% Chemical Purity, Boc–L–Ala–OH–d3, Boc-L-Ala-OH-d3, 0.9802%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 10mg, 100mg, 5mg, 50mg, 50 mg, 100 mg.
(2S)-3,3,3-trideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 161602-47-7) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 192.23 g/mol. IUPAC name: (2S)-3,3,3-trideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QVHJQCGUWFKTSE-MQBGRFPLSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | (2S)-3,3,3-trideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-MQBGRFPLSA-N |
| SMILES | [2H]C([2H])([2H])[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)