CAS 15761-38-3 appears in our catalog under these names: N-tert-Boc-L-alanine, >95% (HPLC), Boc–Ala–OH, Boc-L-Ala-OH, N-Boc-L-alanine, 98+% , Boc-Ala-OH, 98.00%. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 100g, 25g, 5g, 500g, 250g, 0,25kg, 0,5kg, 10g.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 15761-38-3) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QVHJQCGUWFKTSE-YFKPBYRVSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-YFKPBYRVSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)