Products 714964-61-1
CAS 714964-61-1 appears in our catalog under these names: N-tert-Boc-L-alanine-D4, L-Alanine-2,3,3,3-d4-N-t-BOC, 98 atom % D, min 98% Chemical Purity, Boc-L-Ala-OH-d4. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 25mg, 500mg, 0,5g, 0,25g, 250mg, 500 mg, 50 mg, 25 mg.
(2S)-2,3,3,3-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 714964-61-1) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 193.23 g/mol. IUPAC name: (2S)-2,3,3,3-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QVHJQCGUWFKTSE-QXDDTQFUSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | (2S)-2,3,3,3-tetradeuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-QXDDTQFUSA-N |
| SMILES | [2H][C@@](C(=O)O)(C([2H])([2H])[2H])NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)