CAS 177614-70-9 appears in our catalog under these names: D-Alanine-3,3,3-d3-N-t-BOC, 99 atom % D, min 98% Chemical Purity, D–Alanine–3,3,3–N–t–Boc–d3, D-Alanine-3,3,3-N-t-Boc-d3, 98.2%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 10mg, 5 mg, 10 mg.
(2R)-3,3,3-trideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 177614-70-9) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 192.23 g/mol. IUPAC name: (2R)-3,3,3-trideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QVHJQCGUWFKTSE-YXLFGOCJSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 192.23 g/mol |
| IUPAC name | (2R)-3,3,3-trideuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-YXLFGOCJSA-N |
| SMILES | [2H]C([2H])([2H])[C@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)