Products 88181-11-7
CAS 88181-11-7 appears in our catalog under these names: L-Alanine-2-d1-N-t-BOC, 98 atom % D, min 98% Chemical Purity, Boc-L-Ala-OH-d. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5mg, 1mg.
(2S)-2-deuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 88181-11-7) is a chemical compound with the molecular formula C8H15NO4 and a molecular weight of 190.22 g/mol. IUPAC name: (2S)-2-deuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QVHJQCGUWFKTSE-VXNMYXNSSA-N.
| Molecular formula | C8H15NO4 |
|---|---|
| Molecular weight | 190.22 g/mol |
| IUPAC name | (2S)-2-deuterio-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QVHJQCGUWFKTSE-VXNMYXNSSA-N |
| SMILES | [2H][C@](C)(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)