CAS 1218790-92-1 appears in our catalog under these names: (2-((3,5-difluorophenoxy)methyl)phenyl)boronic acid, 95%, 95%, (2-((3,5-Difluorophenoxy)methyl)phenyl)boronic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g.
[2-[(3,5-difluorophenoxy)methyl]phenyl]boronic acid (CAS 1218790-92-1) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: [2-[(3,5-difluorophenoxy)methyl]phenyl]boronic acid. InChIKey: HHJHWQLXFNFSHA-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | [2-[(3,5-difluorophenoxy)methyl]phenyl]boronic acid |
| InChIKey | HHJHWQLXFNFSHA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1COC2=CC(=CC(=C2)F)F)(O)O |
Computed by PubChem (NCBI)