Products 1219386-75-0
CAS 1219386-75-0 appears in our catalog under these names: DL-Carnitine-d9 HCl (trimethyl-d9), 99 atom % D, min 98% Chemical Purity, D,L Carnitine-d9 Chloride, >95% (HPLC), DL–Carnitine–d9 (chloride), (±)-Carnitine-d9 (chloride), 99.69%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 10mg, 25mg, 50mg, 5mg, 1 mg, 10 mg.
(3-carboxy-2-hydroxypropyl)-tris(trideuteriomethyl)azanium chloride (CAS 1219386-75-0) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 206.71 g/mol. IUPAC name: (3-carboxy-2-hydroxypropyl)-tris(trideuteriomethyl)azanium chloride. InChIKey: JXXCENBLGFBQJM-KYRNGWDOSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 206.71 g/mol |
| IUPAC name | (3-carboxy-2-hydroxypropyl)-tris(trideuteriomethyl)azanium chloride |
| InChIKey | JXXCENBLGFBQJM-KYRNGWDOSA-N |
| SMILES | [2H]C([2H])([2H])[N+](CC(CC(=O)O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
D,L Carnitine-d9 Chloride, DL-Carnitine-d9 HCl (trimethyl-d9), DL-Carnitine-d9 (chloride), (3-carboxy-2-hydroxypropyl)-tris(trideuteriomethyl)azanium;chloride, dl Carnitine-d9 Chloride, ( inverted exclamation markA)-Carnitine-d9 (chloride), (C0) L-Carnitine-d9, (3-carboxy-2-hydroxypropyl)tri(?H?)methylazanium chloride, 3-Carboxy-2-hydroxy-N,N,N-tris[(~2~H_3_)methyl]propan-1-aminium chloride, DL-Carnitine-(trimethyl-d9) hydrochloride, 99 atom % D, 98% (CP)