Products 2687961-04-0
CAS 2687961-04-0 appears in our catalog under these names: L-Carnitine-d9 Chloride, L–Carnitine–d9 (chloride), L-Carnitine-d9 (chloride), 99.9%. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 5 mg, 1 mg.
[(2R)-3-carboxy-2-hydroxypropyl]-tris(trideuteriomethyl)azanium chloride (CAS 2687961-04-0) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 206.71 g/mol. IUPAC name: [(2R)-3-carboxy-2-hydroxypropyl]-tris(trideuteriomethyl)azanium chloride. InChIKey: JXXCENBLGFBQJM-YYKKVQPVSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 206.71 g/mol |
| IUPAC name | [(2R)-3-carboxy-2-hydroxypropyl]-tris(trideuteriomethyl)azanium chloride |
| InChIKey | JXXCENBLGFBQJM-YYKKVQPVSA-N |
| SMILES | [2H]C([2H])([2H])[N+](C[C@@H](CC(=O)O)O)(C([2H])([2H])[2H])C([2H])([2H])[2H].[Cl-] |
Computed by PubChem (NCBI)