Products 16224-32-1
CAS 16224-32-1 is the registry number for DL-Carnitine Benzyl Ester Chloride. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride (CAS 16224-32-1) is a chemical compound with the molecular formula C7H16ClNO3 and a molecular weight of 197.66 g/mol. IUPAC name: 3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride. InChIKey: JXXCENBLGFBQJM-UHFFFAOYSA-N.
| Molecular formula | C7H16ClNO3 |
|---|---|
| Molecular weight | 197.66 g/mol |
| IUPAC name | 3-hydroxy-4-(trimethylazaniumyl)butanoate;hydrochloride |
| InChIKey | JXXCENBLGFBQJM-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])O.Cl |
Computed by PubChem (NCBI)
Synonyms:
D,L-Carnitine.HCl (trimethyl-D), 3-Hydroxy-4-(trimethylammonio)butanoate hydrochloride, 3-hydroxy-4-(trimethylazaniumyl)butanoate hydrochloride, C7H16ClNO3, (R)-Carnitine (hydrochloride), (S)-Carnitine (hydrochloride), 3-carboxy-2-hydroxy-N,N,N-trimethylpropan-1-aminium chloride, CARNITINE HYDROCHLORIDE, DL-, D,L-Carnitine.HCl (trimethyl-D9), Tox21_111339