Products 1227381-90-9
CAS 1227381-90-9 is the registry number for tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate oxalate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid (CAS 1227381-90-9) is a chemical compound with the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. IUPAC name: tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid. InChIKey: SMOGGVSZSAELAA-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O6 |
|---|---|
| Molecular weight | 316.35 g/mol |
| IUPAC name | tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid |
| InChIKey | SMOGGVSZSAELAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CNC2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate oxalate, 2,7-Diaza-spiro[3.5]nonane-7-carboxylic acid tert-butyl ester oxalate, tert-butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate;oxalic acid, tert-Butyl 2,7-diazaspiro[3.5]nonane-7-carboxylate oxalic acid, tert-Butyl2,7-diazaspiro[3.5]nonane-7-carboxylateoxalate