Products 123291-97-4
CAS 123291-97-4 appears in our catalog under these names: 2-Ethoxy-5-methylphenylboronic acid, 97%, 97%, 2-Ethoxy-5-methylphenylboronic acid 97%, 2–Ethoxy–5–methylphenylboronic Acid (contains varying amounts of Anhydride), 2-Ethoxy-5-methylphenylboronic Acid (contains varying amounts of Anhydride), 2-Ethoxy-5-methylphenylboronic acid, 98%. Offered by: Chemat, Ambeed, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
(2-ethoxy-5-methylphenyl)boronic acid (CAS 123291-97-4) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (2-ethoxy-5-methylphenyl)boronic acid. InChIKey: KBGGTPGSWHNQEX-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (2-ethoxy-5-methylphenyl)boronic acid |
| InChIKey | KBGGTPGSWHNQEX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)OCC)(O)O |
Computed by PubChem (NCBI)