CAS 92642-95-0 appears in our catalog under these names: 2,3-Dihydro-1,4-benzoxathiine-2-carboxylic acid, 95%, 2,3-Dihydro-1,4-benzoxathiine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2,3-dihydro-1,4-benzoxathiine-2-carboxylic acid (CAS 92642-95-0) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 2,3-dihydro-1,4-benzoxathiine-2-carboxylic acid. InChIKey: ARFWVBWEKBZIMC-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 2,3-dihydro-1,4-benzoxathiine-2-carboxylic acid |
| InChIKey | ARFWVBWEKBZIMC-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2S1)C(=O)O |
Computed by PubChem (NCBI)