CAS 154227-47-1 appears in our catalog under these names: 4-(2-Thienyl)dihydro-2h-pyran-2,6(3H)-dione, 95%, 4-(2-Thienyl)dihydro-2H-pyran-2,6(3H)-dione. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
4-thiophen-2-yloxane-2,6-dione (CAS 154227-47-1) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 4-thiophen-2-yloxane-2,6-dione. InChIKey: YVPSYJQZFMBWIU-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 4-thiophen-2-yloxane-2,6-dione |
| InChIKey | YVPSYJQZFMBWIU-UHFFFAOYSA-N |
| SMILES | C1C(CC(=O)OC1=O)C2=CC=CS2 |
Computed by PubChem (NCBI)