CAS 98733-09-6 appears in our catalog under these names: 6–Methoxybenzo(b)thiophene 1，1–dioxide, 6-Methoxybenzo(b)thiophene 1,1-dioxide, 97%, 6-Methoxybenzo[b]thiophene 1,1-dioxide, 95%, 6-Methoxybenzo[b]thiophene 1,1-dioxide, 95%, 95%. Offered by: GLPBio, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 100mg.
6-methoxy-1-benzothiophene 1,1-dioxide (CAS 98733-09-6) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 6-methoxy-1-benzothiophene 1,1-dioxide. InChIKey: RAMNSGUBDQGSMB-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 6-methoxy-1-benzothiophene 1,1-dioxide |
| InChIKey | RAMNSGUBDQGSMB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=CS2(=O)=O |
Computed by PubChem (NCBI)