CAS 16723-58-3 appears in our catalog under these names: Isothiochroman-4-one 2,2-dioxide, 98%, 1H-​2-​Benzothiopyran-​4(3H)​-​one 2,​2-​dioxide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2,2-dioxo-1H-isothiochromen-4-one (CAS 16723-58-3) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 2,2-dioxo-1H-isothiochromen-4-one. InChIKey: WZCXMBLDKALJTK-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 2,2-dioxo-1H-isothiochromen-4-one |
| InChIKey | WZCXMBLDKALJTK-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(=O)CS1(=O)=O |
Computed by PubChem (NCBI)