CAS 1240526-16-2 is the registry number for (3-(2,2-Difluoroethoxy)phenyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[3-(2,2-difluoroethoxy)phenyl]methanamine;hydrochloride (CAS 1240526-16-2) is a chemical compound with the molecular formula C9H12ClF2NO and a molecular weight of 223.65 g/mol. IUPAC name: [3-(2,2-difluoroethoxy)phenyl]methanamine;hydrochloride. InChIKey: WJDPZOTWYADTMR-UHFFFAOYSA-N.
| Molecular formula | C9H12ClF2NO |
|---|---|
| Molecular weight | 223.65 g/mol |
| IUPAC name | [3-(2,2-difluoroethoxy)phenyl]methanamine;hydrochloride |
| InChIKey | WJDPZOTWYADTMR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(F)F)CN.Cl |
Computed by PubChem (NCBI)