Products 1240528-22-6
CAS 1240528-22-6 appears in our catalog under these names: 2-Amino-2-(3-(trifluoromethyl)phenyl)acetonitrile hydrochloride, 2-Amino-2-(3-(trifluoromethyl)phenyl)acetonitrile hydrochloride, 95%, 95%, 2-Amino-2-[3-(trifluoromethyl)phenyl]acetonitrile hydrochloride, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 500mg.
2-amino-2-[3-(trifluoromethyl)phenyl]acetonitrile;hydrochloride (CAS 1240528-22-6) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 2-amino-2-[3-(trifluoromethyl)phenyl]acetonitrile;hydrochloride. InChIKey: BZDBSWDFNKNCDT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 2-amino-2-[3-(trifluoromethyl)phenyl]acetonitrile;hydrochloride |
| InChIKey | BZDBSWDFNKNCDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(C#N)N.Cl |
Computed by PubChem (NCBI)