CAS 943731-61-1 appears in our catalog under these names: (S)-4-(1-Amino-2,2,2-trifluoroethyl)benzonitrile hydrochloride, 95%, (S)-4-(1-Amino-2,2,2-trifluoroethyl)benzonitrile hydrochloride, 97%, 4-[(1S)-1-amino-2,2,2-trifluoroethyl]benzonitrile hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
4-[(1S)-1-amino-2,2,2-trifluoroethyl]benzonitrile;hydrochloride (CAS 943731-61-1) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 4-[(1S)-1-amino-2,2,2-trifluoroethyl]benzonitrile;hydrochloride. InChIKey: YPALTFQCHARPGS-QRPNPIFTSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 4-[(1S)-1-amino-2,2,2-trifluoroethyl]benzonitrile;hydrochloride |
| InChIKey | YPALTFQCHARPGS-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C#N)[C@@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)