CAS 2251053-71-9 appears in our catalog under these names: 3-Methyl-4-(trifluoromethyl)-1h-indazole hydrochloride, 95%, 3-Methyl-4-(trifluoromethyl)-1H-indazole hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3-methyl-4-(trifluoromethyl)-2H-indazole;hydrochloride (CAS 2251053-71-9) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 3-methyl-4-(trifluoromethyl)-2H-indazole;hydrochloride. InChIKey: IUPSVOJFPMEQSQ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 3-methyl-4-(trifluoromethyl)-2H-indazole;hydrochloride |
| InChIKey | IUPSVOJFPMEQSQ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1)C=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)