CAS 886494-00-4 appears in our catalog under these names: 2-Chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline, 95%, 2-Chloro-4-trifluoromethyl-5,6,7,8-tetrahydro-quinazoline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 0,5g.
2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline (CAS 886494-00-4) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline. InChIKey: POCQYMUTNWQJLH-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 2-chloro-4-(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline |
| InChIKey | POCQYMUTNWQJLH-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NC(=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)