CAS 2089258-17-1 is the registry number for 3-(1-Amino-2,2,2-trifluoroethyl)benzonitrile hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(1-amino-2,2,2-trifluoroethyl)benzonitrile;hydrochloride (CAS 2089258-17-1) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 3-(1-amino-2,2,2-trifluoroethyl)benzonitrile;hydrochloride. InChIKey: DGVNEUNKAWOROO-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 3-(1-amino-2,2,2-trifluoroethyl)benzonitrile;hydrochloride |
| InChIKey | DGVNEUNKAWOROO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C(F)(F)F)N)C#N.Cl |
Computed by PubChem (NCBI)