CAS 127952-87-8 appears in our catalog under these names: 2-Amino-2-(2-(trifluoromethyl)phenyl)acetonitrile hydrochloride, 95%, 2-Amino-2-(2-(trifluoromethyl)phenyl)acetonitrile hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
2-amino-2-[2-(trifluoromethyl)phenyl]acetonitrile;hydrochloride (CAS 127952-87-8) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 2-amino-2-[2-(trifluoromethyl)phenyl]acetonitrile;hydrochloride. InChIKey: JRLNCKJANLAWOX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 2-amino-2-[2-(trifluoromethyl)phenyl]acetonitrile;hydrochloride |
| InChIKey | JRLNCKJANLAWOX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C#N)N)C(F)(F)F.Cl |
Computed by PubChem (NCBI)