CAS 1781241-45-9 is the registry number for 2–(Azetidin–3–yl)–3–chloro–5–(trifluoromethyl)pyridine. Offered by: GLPBio. Available pack sizes: 100mg.
2-(azetidin-3-yl)-3-chloro-5-(trifluoromethyl)pyridine (CAS 1781241-45-9) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 2-(azetidin-3-yl)-3-chloro-5-(trifluoromethyl)pyridine. InChIKey: JZZDNFZTLIHXBE-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 2-(azetidin-3-yl)-3-chloro-5-(trifluoromethyl)pyridine |
| InChIKey | JZZDNFZTLIHXBE-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)