Products 2007921-17-5
CAS 2007921-17-5 is the registry number for 3-(Trifluoromethyl)-1H-indol-6-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 100mg.
3-(trifluoromethyl)-1H-indol-6-amine;hydrochloride (CAS 2007921-17-5) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 3-(trifluoromethyl)-1H-indol-6-amine;hydrochloride. InChIKey: WYUYNEXRVDJIDX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 3-(trifluoromethyl)-1H-indol-6-amine;hydrochloride |
| InChIKey | WYUYNEXRVDJIDX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)NC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)