Products 2375268-83-8
CAS 2375268-83-8 appears in our catalog under these names: 4-(1-Amino-2,2,2-trifluoroethyl)benzonitrile hydrochloride, 98%, 4-(1-Amino-2,2,2-trifluoroethyl)benzonitrile hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(1-amino-2,2,2-trifluoroethyl)benzonitrile;hydrochloride (CAS 2375268-83-8) is a chemical compound with the molecular formula C9H8ClF3N2 and a molecular weight of 236.62 g/mol. IUPAC name: 4-(1-amino-2,2,2-trifluoroethyl)benzonitrile;hydrochloride. InChIKey: YPALTFQCHARPGS-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3N2 |
|---|---|
| Molecular weight | 236.62 g/mol |
| IUPAC name | 4-(1-amino-2,2,2-trifluoroethyl)benzonitrile;hydrochloride |
| InChIKey | YPALTFQCHARPGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)