CAS 1241046-32-1 appears in our catalog under these names: QM295, 98%, QM295, QM295, 98.53%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 100mg, 25mg, 50mg, 1mg, 5 mg.
(4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one (CAS 1241046-32-1) is a chemical compound with the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. IUPAC name: (4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one. InChIKey: LRCZCFNUNZQGGK-LCYFTJDESA-N.
| Molecular formula | C17H13NO4 |
|---|---|
| Molecular weight | 295.29 g/mol |
| IUPAC name | (4Z)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-3-phenyl-1,2-oxazol-5-one |
| InChIKey | LRCZCFNUNZQGGK-LCYFTJDESA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C\2/C(=NOC2=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)