CAS 1241684-20-7 is the registry number for (S)-1-(4-Chloro-2,6-difluorophenyl)ethan-1-amine, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 50mg.
(1S)-1-(4-chloro-2,6-difluorophenyl)ethanamine (CAS 1241684-20-7) is a chemical compound with the molecular formula C8H8ClF2N and a molecular weight of 191.60 g/mol. IUPAC name: (1S)-1-(4-chloro-2,6-difluorophenyl)ethanamine. InChIKey: PTAKYWYOQWWZRN-BYPYZUCNSA-N.
| Molecular formula | C8H8ClF2N |
|---|---|
| Molecular weight | 191.60 g/mol |
| IUPAC name | (1S)-1-(4-chloro-2,6-difluorophenyl)ethanamine |
| InChIKey | PTAKYWYOQWWZRN-BYPYZUCNSA-N |
| SMILES | C[C@@H](C1=C(C=C(C=C1F)Cl)F)N |
Computed by PubChem (NCBI)