Products 189083-63-4

CAS 189083-63-4 appears in our catalog under these names: 5–(4–Nitrophenyl)–1H–pyrazole–3–carboxylic acid, 5-(4-Nitrophenyl)-1H-pyrazole-3-carboxylic acid, 97+%, 97+%, 5-(4-Nitrophenyl)-1H-pyrazole-3-carboxylic acid, 97+%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-(4-nitrophenyl)-1H-pyrazole-5-carboxylic acid (CAS 189083-63-4) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 3-(4-nitrophenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: YTCUAJQXEKPQMF-UHFFFAOYSA-N.

Identity
Molecular formulaC10H7N3O4
Molecular weight233.18 g/mol
IUPAC name3-(4-nitrophenyl)-1H-pyrazole-5-carboxylic acid
InChIKeyYTCUAJQXEKPQMF-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C2=NNC(=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)