CAS 1542688-79-8 is the registry number for 2-Oxo-1,2,3,7-tetrahydro-[1,4]oxazino[3,2-e]indazole-9-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-1,7-dihydropyrazolo[4,3-f][1,4]benzoxazine-9-carboxylic acid (CAS 1542688-79-8) is a chemical compound with the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. IUPAC name: 2-oxo-1,7-dihydropyrazolo[4,3-f][1,4]benzoxazine-9-carboxylic acid. InChIKey: IHEPXOAGYGCHIP-UHFFFAOYSA-N.
| Molecular formula | C10H7N3O4 |
|---|---|
| Molecular weight | 233.18 g/mol |
| IUPAC name | 2-oxo-1,7-dihydropyrazolo[4,3-f][1,4]benzoxazine-9-carboxylic acid |
| InChIKey | IHEPXOAGYGCHIP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=CC3=C2C(=NN3)C(=O)O |
Computed by PubChem (NCBI)