Products 1247192-90-0
CAS 1247192-90-0 appears in our catalog under these names: 3-Bromo-4-(2,4-difluorophenyl)butan-2-one, 95%, 3-Bromo-4-(2,4-difluorophenyl)butan-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
3-bromo-4-(2,4-difluorophenyl)butan-2-one (CAS 1247192-90-0) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: 3-bromo-4-(2,4-difluorophenyl)butan-2-one. InChIKey: RQXBZTMMKYICMJ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 3-bromo-4-(2,4-difluorophenyl)butan-2-one |
| InChIKey | RQXBZTMMKYICMJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CC1=C(C=C(C=C1)F)F)Br |
Computed by PubChem (NCBI)