Products 2803933-36-8
CAS 2803933-36-8 is the registry number for 1-(3-Bromo-5-(1,1-difluoroethyl)phenyl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethanone (CAS 2803933-36-8) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: 1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethanone. InChIKey: IYTBVXHGGWYSEO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 1-[3-bromo-5-(1,1-difluoroethyl)phenyl]ethanone |
| InChIKey | IYTBVXHGGWYSEO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC(=C1)Br)C(C)(F)F |
Computed by PubChem (NCBI)