Products 2098118-22-8
CAS 2098118-22-8 appears in our catalog under these names: (3–(4–bromophenyl)–2，2–difluorocyclopropyl)methanol, (3-(4-bromophenyl)-2，2-difluorocyclopropyl)methanol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
[3-(4-bromophenyl)-2,2-difluorocyclopropyl]methanol (CAS 2098118-22-8) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: [3-(4-bromophenyl)-2,2-difluorocyclopropyl]methanol. InChIKey: VDHSLLLIRILCKQ-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | [3-(4-bromophenyl)-2,2-difluorocyclopropyl]methanol |
| InChIKey | VDHSLLLIRILCKQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2C(C2(F)F)CO)Br |
Computed by PubChem (NCBI)