CAS 1310094-20-2 is the registry number for 2-Bromo-1-(3,4-difluorophenyl)-2-methylpropan-1-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-1-(3,4-difluorophenyl)-2-methylpropan-1-one (CAS 1310094-20-2) is a chemical compound with the molecular formula C10H9BrF2O and a molecular weight of 263.08 g/mol. IUPAC name: 2-bromo-1-(3,4-difluorophenyl)-2-methylpropan-1-one. InChIKey: PNDHFLKTIRTTOK-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2O |
|---|---|
| Molecular weight | 263.08 g/mol |
| IUPAC name | 2-bromo-1-(3,4-difluorophenyl)-2-methylpropan-1-one |
| InChIKey | PNDHFLKTIRTTOK-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)C1=CC(=C(C=C1)F)F)Br |
Computed by PubChem (NCBI)